C30H35ClN6O5 — CID 175743473
butyl 4-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenoxy]pyrimidin-2-yl]amino]-3-methoxyphenyl]-1,4-diazepane-1-carboxylate (PubChem CID 175743473) has the molecular formula C30H35ClN6O5 and a molecular weight of 595.10 g/mol. Its IUPAC name is butyl 4-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenoxy]pyrimidin-2-yl]amino]-3-methoxyphenyl]-1,4-diazepane-1-carboxylate.
| Compound Name | butyl 4-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenoxy]pyrimidin-2-yl]amino]-3-methoxyphenyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 175743473 |
| Molecular Formula | C30H35ClN6O5 |
| Molecular Weight | 595.10 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | butyl 4-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenoxy]pyrimidin-2-yl]amino]-3-methoxyphenyl]-1,4-diazepane-1-carboxylate |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCCN(C(=O)OCCCC)CC4)cc3OC)ncc2Cl)c1 |
| InChI | InChI=1S/C30H35ClN6O5/c1-4-6-17-41-30(39)37-14-8-13-36(15-16-37)22-11-12-25(26(19-22)40-3)34-29-32-20-24(31)28(35-29)42-23-10-7-9-21(18-23)33-27(38)5-2/h5,7,9-12,18-20H,2,4,6,8,13-17H2,1,3H3,(H,33,38)(H,32,34,35) |
| InChIKey | FUTMLVQVTKFWSY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.10 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|