C26H26ClFN6O4 — CID 162656842
N-[3-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-chloropyrimidin-4-yl]oxyphenyl]-2-fluoroprop-2-enamide (PubChem CID 162656842) has the molecular formula C26H26ClFN6O4 and a molecular weight of 540.98 g/mol. Its IUPAC name is N-[3-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-chloropyrimidin-4-yl]oxyphenyl]-2-fluoroprop-2-enamide.
| Compound Name | N-[3-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-chloropyrimidin-4-yl]oxyphenyl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 162656842 |
| Molecular Formula | C26H26ClFN6O4 |
| Molecular Weight | 540.98 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | N-[3-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-chloropyrimidin-4-yl]oxyphenyl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C(C)=O)CC4)cc3OC)ncc2Cl)c1 |
| InChI | InChI=1S/C26H26ClFN6O4/c1-16(28)24(36)30-18-5-4-6-20(13-18)38-25-21(27)15-29-26(32-25)31-22-8-7-19(14-23(22)37-3)34-11-9-33(10-12-34)17(2)35/h4-8,13-15H,1,9-12H2,2-3H3,(H,30,36)(H,29,31,32) |
| InChIKey | JCERJFZOZDMVGG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.98 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|