C23H23ClN6O5 — CID 86729634
1-[4-[4-[[5-chloro-4-(2-nitrophenoxy)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperazin-1-yl]ethanone (PubChem CID 86729634) has the molecular formula C23H23ClN6O5 and a molecular weight of 498.93 g/mol. Its IUPAC name is 1-[4-[4-[[5-chloro-4-(2-nitrophenoxy)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[[5-chloro-4-(2-nitrophenoxy)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 86729634 |
| Molecular Formula | C23H23ClN6O5 |
| Molecular Weight | 498.93 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 1-[4-[4-[[5-chloro-4-(2-nitrophenoxy)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperazin-1-yl]ethanone |
| SMILES | COc1cc(N2CCN(C(C)=O)CC2)ccc1Nc1ncc(Cl)c(Oc2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C23H23ClN6O5/c1-15(31)28-9-11-29(12-10-28)16-7-8-18(21(13-16)34-2)26-23-25-14-17(24)22(27-23)35-20-6-4-3-5-19(20)30(32)33/h3-8,13-14H,9-12H2,1-2H3,(H,25,26,27) |
| InChIKey | AOCFTVABEGDWNR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.93 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|