C27H28FN5O4 — CID 146801377
1-[2-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-fluoropyrimidin-4-yl]oxyphenyl]but-3-en-2-one (PubChem CID 146801377) has the molecular formula C27H28FN5O4 and a molecular weight of 505.55 g/mol. Its IUPAC name is 1-[2-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-fluoropyrimidin-4-yl]oxyphenyl]but-3-en-2-one.
| Compound Name | 1-[2-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-fluoropyrimidin-4-yl]oxyphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 146801377 |
| Molecular Formula | C27H28FN5O4 |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 1-[2-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-fluoropyrimidin-4-yl]oxyphenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1ccccc1Oc1nc(Nc2ccc(N3CCN(C(C)=O)CC3)cc2OC)ncc1F |
| InChI | InChI=1S/C27H28FN5O4/c1-4-21(35)15-19-7-5-6-8-24(19)37-26-22(28)17-29-27(31-26)30-23-10-9-20(16-25(23)36-3)33-13-11-32(12-14-33)18(2)34/h4-10,16-17H,1,11-15H2,2-3H3,(H,29,30,31) |
| InChIKey | RXYXRBONPWUHDM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|