C26H27ClN6O4 — CID 86729636
N-[2-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-chloropyrimidin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 86729636) has the molecular formula C26H27ClN6O4 and a molecular weight of 522.99 g/mol. Its IUPAC name is N-[2-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-chloropyrimidin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[2-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-chloropyrimidin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86729636 |
| Molecular Formula | C26H27ClN6O4 |
| Molecular Weight | 522.99 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | N-[2-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-chloropyrimidin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Oc1nc(Nc2ccc(N3CCN(C(C)=O)CC3)cc2OC)ncc1Cl |
| InChI | InChI=1S/C26H27ClN6O4/c1-4-24(35)29-20-7-5-6-8-22(20)37-25-19(27)16-28-26(31-25)30-21-10-9-18(15-23(21)36-3)33-13-11-32(12-14-33)17(2)34/h4-10,15-16H,1,11-14H2,2-3H3,(H,29,35)(H,28,30,31) |
| InChIKey | SXKSYQOZLJFAPW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.99 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|