C25H27ClN8O3 — CID 141482944
N-[6-[[4-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-chloropyrimidin-2-yl]amino]-2-pyridinyl]prop-2-enamide (PubChem CID 141482944) has the molecular formula C25H27ClN8O3 and a molecular weight of 523.00 g/mol. Its IUPAC name is N-[6-[[4-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-chloropyrimidin-2-yl]amino]-2-pyridinyl]prop-2-enamide.
| Compound Name | N-[6-[[4-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-chloropyrimidin-2-yl]amino]-2-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 141482944 |
| Molecular Formula | C25H27ClN8O3 |
| Molecular Weight | 523.00 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | N-[6-[[4-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-chloropyrimidin-2-yl]amino]-2-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2ncc(Cl)c(Nc3ccc(N4CCN(C(C)=O)CC4)cc3OC)n2)n1 |
| InChI | InChI=1S/C25H27ClN8O3/c1-4-23(36)30-21-6-5-7-22(29-21)31-25-27-15-18(26)24(32-25)28-19-9-8-17(14-20(19)37-3)34-12-10-33(11-13-34)16(2)35/h4-9,14-15H,1,10-13H2,2-3H3,(H3,27,28,29,30,31,32,36) |
| InChIKey | LXHWBCZRAFGFLX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.00 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|