C25H27ClN6O3 — CID 118638698
N-[2-[[5-chloro-2-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-methoxyanilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 118638698) has the molecular formula C25H27ClN6O3 and a molecular weight of 494.98 g/mol. Its IUPAC name is N-[2-[[5-chloro-2-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-methoxyanilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[5-chloro-2-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-methoxyanilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118638698 |
| Molecular Formula | C25H27ClN6O3 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | N-[2-[[5-chloro-2-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-methoxyanilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1nc(Nc2ccc(N3CCC[C@@H]3CO)cc2OC)ncc1Cl |
| InChI | InChI=1S/C25H27ClN6O3/c1-3-23(34)28-19-8-4-5-9-20(19)29-24-18(26)14-27-25(31-24)30-21-11-10-16(13-22(21)35-2)32-12-6-7-17(32)15-33/h3-5,8-11,13-14,17,33H,1,6-7,12,15H2,2H3,(H,28,34)(H2,27,29,30,31)/t17-/m1/s1 |
| InChIKey | SSNVNHJCWNIFOS-QGZVFWFLSA-N |
| XLogP | 4.71 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|