C20H16ClF2N5O2 — CID 90331344
N-[2-[[5-chloro-2-(4-fluoro-2-methoxyanilino)pyrimidin-4-yl]amino]-5-fluorophenyl]prop-2-enamide (PubChem CID 90331344) has the molecular formula C20H16ClF2N5O2 and a molecular weight of 431.83 g/mol. Its IUPAC name is N-[2-[[5-chloro-2-(4-fluoro-2-methoxyanilino)pyrimidin-4-yl]amino]-5-fluorophenyl]prop-2-enamide.
| Compound Name | N-[2-[[5-chloro-2-(4-fluoro-2-methoxyanilino)pyrimidin-4-yl]amino]-5-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90331344 |
| Molecular Formula | C20H16ClF2N5O2 |
| Molecular Weight | 431.83 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | N-[2-[[5-chloro-2-(4-fluoro-2-methoxyanilino)pyrimidin-4-yl]amino]-5-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(F)ccc1Nc1nc(Nc2ccc(F)cc2OC)ncc1Cl |
| InChI | InChI=1S/C20H16ClF2N5O2/c1-3-18(29)25-16-8-11(22)4-6-14(16)26-19-13(21)10-24-20(28-19)27-15-7-5-12(23)9-17(15)30-2/h3-10H,1H2,2H3,(H,25,29)(H2,24,26,27,28) |
| InChIKey | DACUJAKKBOULKS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.83 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|