C24H22ClFN6O4 — CID 87055269
N-[5-[[5-chloro-4-[2-[2-(dimethylamino)-2-oxoacetyl]anilino]pyrimidin-2-yl]amino]-4-fluoro-2-methoxyphenyl]prop-2-enamide (PubChem CID 87055269) has the molecular formula C24H22ClFN6O4 and a molecular weight of 512.93 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-[2-[2-(dimethylamino)-2-oxoacetyl]anilino]pyrimidin-2-yl]amino]-4-fluoro-2-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-[2-[2-(dimethylamino)-2-oxoacetyl]anilino]pyrimidin-2-yl]amino]-4-fluoro-2-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 87055269 |
| Molecular Formula | C24H22ClFN6O4 |
| Molecular Weight | 512.93 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | N-[5-[[5-chloro-4-[2-[2-(dimethylamino)-2-oxoacetyl]anilino]pyrimidin-2-yl]amino]-4-fluoro-2-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccccc3C(=O)C(=O)N(C)C)n2)c(F)cc1OC |
| InChI | InChI=1S/C24H22ClFN6O4/c1-5-20(33)28-18-11-17(15(26)10-19(18)36-4)30-24-27-12-14(25)22(31-24)29-16-9-7-6-8-13(16)21(34)23(35)32(2)3/h5-12H,1H2,2-4H3,(H,28,33)(H2,27,29,30,31) |
| InChIKey | UAIQANFZHONYNQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.93 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|