C26H25ClN6O4 — CID 87055677
N-[5-[[5-chloro-4-[2-[2-(dimethylamino)-2-oxoacetyl]anilino]pyrimidin-2-yl]amino]-2-cyclopropyloxyphenyl]prop-2-enamide (PubChem CID 87055677) has the molecular formula C26H25ClN6O4 and a molecular weight of 520.98 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-[2-[2-(dimethylamino)-2-oxoacetyl]anilino]pyrimidin-2-yl]amino]-2-cyclopropyloxyphenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-[2-[2-(dimethylamino)-2-oxoacetyl]anilino]pyrimidin-2-yl]amino]-2-cyclopropyloxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 87055677 |
| Molecular Formula | C26H25ClN6O4 |
| Molecular Weight | 520.98 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | N-[5-[[5-chloro-4-[2-[2-(dimethylamino)-2-oxoacetyl]anilino]pyrimidin-2-yl]amino]-2-cyclopropyloxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccccc3C(=O)C(=O)N(C)C)n2)ccc1OC1CC1 |
| InChI | InChI=1S/C26H25ClN6O4/c1-4-22(34)30-20-13-15(9-12-21(20)37-16-10-11-16)29-26-28-14-18(27)24(32-26)31-19-8-6-5-7-17(19)23(35)25(36)33(2)3/h4-9,12-14,16H,1,10-11H2,2-3H3,(H,30,34)(H2,28,29,31,32) |
| InChIKey | ZWECPWDKNQOSQQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.98 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|