C23H19ClN6O3 — CID 134224381
2-[2-[[5-chloro-2-[(2-oxo-1H-quinolin-6-yl)amino]pyrimidin-4-yl]amino]phenyl]-N,N-dimethyl-2-oxoacetamide (PubChem CID 134224381) has the molecular formula C23H19ClN6O3 and a molecular weight of 462.90 g/mol. Its IUPAC name is 2-[2-[[5-chloro-2-[(2-oxo-1H-quinolin-6-yl)amino]pyrimidin-4-yl]amino]phenyl]-N,N-dimethyl-2-oxoacetamide.
| Compound Name | 2-[2-[[5-chloro-2-[(2-oxo-1H-quinolin-6-yl)amino]pyrimidin-4-yl]amino]phenyl]-N,N-dimethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 134224381 |
| Molecular Formula | C23H19ClN6O3 |
| Molecular Weight | 462.90 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 2-[2-[[5-chloro-2-[(2-oxo-1H-quinolin-6-yl)amino]pyrimidin-4-yl]amino]phenyl]-N,N-dimethyl-2-oxoacetamide |
| SMILES | CN(C)C(=O)C(=O)c1ccccc1Nc1nc(Nc2ccc3[nH]c(=O)ccc3c2)ncc1Cl |
| InChI | InChI=1S/C23H19ClN6O3/c1-30(2)22(33)20(32)15-5-3-4-6-18(15)28-21-16(24)12-25-23(29-21)26-14-8-9-17-13(11-14)7-10-19(31)27-17/h3-12H,1-2H3,(H,27,31)(H2,25,26,28,29) |
| InChIKey | HHJGROGMFGQMMV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.90 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|