C22H19ClN6O3 — CID 134224346
2-[2-[[5-chloro-2-[(2-oxo-1,3-dihydroindol-5-yl)amino]pyrimidin-4-yl]amino]phenyl]-N,N-dimethyl-2-oxoacetamide (PubChem CID 134224346) has the molecular formula C22H19ClN6O3 and a molecular weight of 450.89 g/mol. Its IUPAC name is 2-[2-[[5-chloro-2-[(2-oxo-1,3-dihydroindol-5-yl)amino]pyrimidin-4-yl]amino]phenyl]-N,N-dimethyl-2-oxoacetamide.
| Compound Name | 2-[2-[[5-chloro-2-[(2-oxo-1,3-dihydroindol-5-yl)amino]pyrimidin-4-yl]amino]phenyl]-N,N-dimethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 134224346 |
| Molecular Formula | C22H19ClN6O3 |
| Molecular Weight | 450.89 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 2-[2-[[5-chloro-2-[(2-oxo-1,3-dihydroindol-5-yl)amino]pyrimidin-4-yl]amino]phenyl]-N,N-dimethyl-2-oxoacetamide |
| SMILES | CN(C)C(=O)C(=O)c1ccccc1Nc1nc(Nc2ccc3c(c2)CC(=O)N3)ncc1Cl |
| InChI | InChI=1S/C22H19ClN6O3/c1-29(2)21(32)19(31)14-5-3-4-6-17(14)27-20-15(23)11-24-22(28-20)25-13-7-8-16-12(9-13)10-18(30)26-16/h3-9,11H,10H2,1-2H3,(H,26,30)(H2,24,25,27,28) |
| InChIKey | HKDYNVHNKGDZCR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.89 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|