C24H25ClN5O4P — CID 90066263
N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-(oxetan-3-yloxy)phenyl]prop-2-enamide (PubChem CID 90066263) has the molecular formula C24H25ClN5O4P and a molecular weight of 513.92 g/mol. Its IUPAC name is N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-(oxetan-3-yloxy)phenyl]prop-2-enamide.
| Compound Name | N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-(oxetan-3-yloxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90066263 |
| Molecular Formula | C24H25ClN5O4P |
| Molecular Weight | 513.92 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-(oxetan-3-yloxy)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(OC2COC2)c(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c1 |
| InChI | InChI=1S/C24H25ClN5O4P/c1-4-22(31)27-15-9-10-20(34-16-13-33-14-16)19(11-15)29-24-26-12-17(25)23(30-24)28-18-7-5-6-8-21(18)35(2,3)32/h4-12,16H,1,13-14H2,2-3H3,(H,27,31)(H2,26,28,29,30) |
| InChIKey | AQCLBCBJIDFTAP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|