C26H32ClN6O3P — CID 90066246
N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]-N-[2-(dimethylamino)ethyl]prop-2-enamide (PubChem CID 90066246) has the molecular formula C26H32ClN6O3P and a molecular weight of 543.01 g/mol. Its IUPAC name is N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]-N-[2-(dimethylamino)ethyl]prop-2-enamide.
| Compound Name | N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]-N-[2-(dimethylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 90066246 |
| Molecular Formula | C26H32ClN6O3P |
| Molecular Weight | 543.01 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]-N-[2-(dimethylamino)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CCN(C)C)c1ccc(OC)c(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c1 |
| InChI | InChI=1S/C26H32ClN6O3P/c1-7-24(34)33(15-14-32(2)3)18-12-13-22(36-4)21(16-18)30-26-28-17-19(27)25(31-26)29-20-10-8-9-11-23(20)37(5,6)35/h7-13,16-17H,1,14-15H2,2-6H3,(H2,28,29,30,31) |
| InChIKey | VKYAFQAAUIUVBL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.01 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|