C28H37ClN7O3P — CID 89156464
N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2-[3-(dimethylamino)propyl-methylamino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 89156464) has the molecular formula C28H37ClN7O3P and a molecular weight of 586.08 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2-[3-(dimethylamino)propyl-methylamino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2-[3-(dimethylamino)propyl-methylamino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 89156464 |
| Molecular Formula | C28H37ClN7O3P |
| Molecular Weight | 586.08 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2-[3-(dimethylamino)propyl-methylamino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c(OC)cc1N(C)CCCN(C)C |
| InChI | InChI=1S/C28H37ClN7O3P/c1-8-26(37)31-21-16-22(24(39-5)17-23(21)36(4)15-11-14-35(2)3)33-28-30-18-19(29)27(34-28)32-20-12-9-10-13-25(20)40(6,7)38/h8-10,12-13,16-18H,1,11,14-15H2,2-7H3,(H,31,37)(H2,30,32,33,34) |
| InChIKey | VXIRFWLLCRLWBZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.08 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|