C24H28ClN6O3P — CID 89182819
N-[2-(2-aminoethyl)-5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 89182819) has the molecular formula C24H28ClN6O3P and a molecular weight of 514.95 g/mol. Its IUPAC name is N-[2-(2-aminoethyl)-5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[2-(2-aminoethyl)-5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 89182819 |
| Molecular Formula | C24H28ClN6O3P |
| Molecular Weight | 514.95 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | N-[2-(2-aminoethyl)-5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c(OC)cc1CCN |
| InChI | InChI=1S/C24H28ClN6O3P/c1-5-22(32)28-18-13-19(20(34-2)12-15(18)10-11-26)30-24-27-14-16(25)23(31-24)29-17-8-6-7-9-21(17)35(3,4)33/h5-9,12-14H,1,10-11,26H2,2-4H3,(H,28,32)(H2,27,29,30,31) |
| InChIKey | OYJOJOAPMYGFSC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.95 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|