C24H27ClN5O3P — CID 123398439
N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]pent-2-enamide (PubChem CID 123398439) has the molecular formula C24H27ClN5O3P and a molecular weight of 499.94 g/mol. Its IUPAC name is N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]pent-2-enamide.
| Compound Name | N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]pent-2-enamide |
|---|---|
| PubChem CID | 123398439 |
| Molecular Formula | C24H27ClN5O3P |
| Molecular Weight | 499.94 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]pent-2-enamide |
| SMILES | CCC=CC(=O)Nc1ccc(OC)c(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c1 |
| InChI | InChI=1S/C24H27ClN5O3P/c1-5-6-11-22(31)27-16-12-13-20(33-2)19(14-16)29-24-26-15-17(25)23(30-24)28-18-9-7-8-10-21(18)34(3,4)32/h6-15H,5H2,1-4H3,(H,27,31)(H2,26,28,29,30) |
| InChIKey | SVAWZMIBUPOMOT-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.94 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|