C31H32ClN7O3 — CID 121371233
(E)-4-(4-acetylpiperazin-1-yl)-N-[3-[[5-chloro-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide (PubChem CID 121371233) has the molecular formula C31H32ClN7O3 and a molecular weight of 586.10 g/mol. Its IUPAC name is (E)-4-(4-acetylpiperazin-1-yl)-N-[3-[[5-chloro-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide.
| Compound Name | (E)-4-(4-acetylpiperazin-1-yl)-N-[3-[[5-chloro-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide |
|---|---|
| PubChem CID | 121371233 |
| Molecular Formula | C31H32ClN7O3 |
| Molecular Weight | 586.10 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | (E)-4-(4-acetylpiperazin-1-yl)-N-[3-[[5-chloro-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/CN2CCN(C(C)=O)CC2)cc1Nc1ncc(Cl)c(Nc2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C31H32ClN7O3/c1-21(40)39-16-14-38(15-17-39)13-5-8-29(41)34-25-11-12-28(42-2)27(19-25)36-31-33-20-26(32)30(37-31)35-24-10-9-22-6-3-4-7-23(22)18-24/h3-12,18-20H,13-17H2,1-2H3,(H,34,41)(H2,33,35,36,37)/b8-5+ |
| InChIKey | JGGWFQGOKNBLAU-VMPITWQZSA-N |
| XLogP | 5.44 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.10 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|