C37H51ClN9O3P — CID 176856571
(E)-N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-4-piperidin-1-ylbut-2-enamide (PubChem CID 176856571) has the molecular formula C37H51ClN9O3P and a molecular weight of 736.30 g/mol. Its IUPAC name is (E)-N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-4-piperidin-1-ylbut-2-enamide.
| Compound Name | (E)-N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-4-piperidin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 176856571 |
| Molecular Formula | C37H51ClN9O3P |
| Molecular Weight | 736.30 g/mol |
| Exact Mass | 735.35 |
| IUPAC Name | (E)-N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-4-piperidin-1-ylbut-2-enamide |
| SMILES | COc1cc(N2CCC(N3CCNCC3)CC2)c(NC(=O)/C=C/CN2CCCCC2)cc1Nc1ncc(Cl)c(Nc2ccccc2P(C)(C)=O)n1 |
| InChI | InChI=1S/C37H51ClN9O3P/c1-50-33-25-32(47-20-13-27(14-21-47)46-22-15-39-16-23-46)30(41-35(48)12-9-19-45-17-7-4-8-18-45)24-31(33)43-37-40-26-28(38)36(44-37)42-29-10-5-6-11-34(29)51(2,3)49/h5-6,9-12,24-27,39H,4,7-8,13-23H2,1-3H3,(H,41,48)(H2,40,42,43,44)/b12-9+ |
| InChIKey | LUNNZLNZBHJLHR-FMIVXFBMSA-N |
| XLogP | 5.73 |
| TPSA | 126.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.30 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|