C33H44ClN8O3P — CID 176856572
N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-3-methylbut-2-enamide (PubChem CID 176856572) has the molecular formula C33H44ClN8O3P and a molecular weight of 667.20 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-3-methylbut-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 176856572 |
| Molecular Formula | C33H44ClN8O3P |
| Molecular Weight | 667.20 g/mol |
| Exact Mass | 666.30 |
| IUPAC Name | N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-(4-piperazin-1-ylpiperidin-1-yl)phenyl]-3-methylbut-2-enamide |
| SMILES | COc1cc(N2CCC(N3CCNCC3)CC2)c(NC(=O)C=C(C)C)cc1Nc1ncc(Cl)c(Nc2ccccc2P(C)(C)=O)n1 |
| InChI | InChI=1S/C33H44ClN8O3P/c1-22(2)18-31(43)37-26-19-27(29(45-3)20-28(26)42-14-10-23(11-15-42)41-16-12-35-13-17-41)39-33-36-21-24(34)32(40-33)38-25-8-6-7-9-30(25)46(4,5)44/h6-9,18-21,23,35H,10-17H2,1-5H3,(H,37,43)(H2,36,38,39,40) |
| InChIKey | IQXSUBZCIWIOHT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.20 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|