C25H29ClN5O3P — CID 177118027
[4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]-piperidin-4-ylmethanone (PubChem CID 177118027) has the molecular formula C25H29ClN5O3P and a molecular weight of 513.97 g/mol. Its IUPAC name is [4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]-piperidin-4-ylmethanone.
| Compound Name | [4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]-piperidin-4-ylmethanone |
|---|---|
| PubChem CID | 177118027 |
| Molecular Formula | C25H29ClN5O3P |
| Molecular Weight | 513.97 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | [4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]-piperidin-4-ylmethanone |
| SMILES | COc1cc(C(=O)C2CCNCC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2P(C)(C)=O)n1 |
| InChI | InChI=1S/C25H29ClN5O3P/c1-34-21-14-17(23(32)16-10-12-27-13-11-16)8-9-19(21)30-25-28-15-18(26)24(31-25)29-20-6-4-5-7-22(20)35(2,3)33/h4-9,14-16,27H,10-13H2,1-3H3,(H2,28,29,30,31) |
| InChIKey | OUDUSEUQNMCEEL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.97 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|