C23H25ClN5O2P — CID 90066353
2-N-(5-amino-4-but-1-ynyl-2-methoxyphenyl)-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 90066353) has the molecular formula C23H25ClN5O2P and a molecular weight of 469.91 g/mol. Its IUPAC name is 2-N-(5-amino-4-but-1-ynyl-2-methoxyphenyl)-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(5-amino-4-but-1-ynyl-2-methoxyphenyl)-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 90066353 |
| Molecular Formula | C23H25ClN5O2P |
| Molecular Weight | 469.91 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 2-N-(5-amino-4-but-1-ynyl-2-methoxyphenyl)-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | CCC#Cc1cc(OC)c(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)cc1N |
| InChI | InChI=1S/C23H25ClN5O2P/c1-5-6-9-15-12-20(31-2)19(13-17(15)25)28-23-26-14-16(24)22(29-23)27-18-10-7-8-11-21(18)32(3,4)30/h7-8,10-14H,5,25H2,1-4H3,(H2,26,27,28,29) |
| InChIKey | OMWXVEHDYVCNLC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.91 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|