C26H31ClN5O3P — CID 167272762
1-[4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2-ethyl-5-methoxyphenyl]piperidin-4-one (PubChem CID 167272762) has the molecular formula C26H31ClN5O3P and a molecular weight of 527.99 g/mol. Its IUPAC name is 1-[4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2-ethyl-5-methoxyphenyl]piperidin-4-one.
| Compound Name | 1-[4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2-ethyl-5-methoxyphenyl]piperidin-4-one |
|---|---|
| PubChem CID | 167272762 |
| Molecular Formula | C26H31ClN5O3P |
| Molecular Weight | 527.99 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 1-[4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2-ethyl-5-methoxyphenyl]piperidin-4-one |
| SMILES | CCc1cc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c(OC)cc1N1CCC(=O)CC1 |
| InChI | InChI=1S/C26H31ClN5O3P/c1-5-17-14-21(23(35-2)15-22(17)32-12-10-18(33)11-13-32)30-26-28-16-19(27)25(31-26)29-20-8-6-7-9-24(20)36(3,4)34/h6-9,14-16H,5,10-13H2,1-4H3,(H2,28,29,30,31) |
| InChIKey | NGMKPDJVWGDPGQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.99 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|