C26H28ClN6O2P — CID 167272855
2-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-ethyl-5-(4-oxopiperidin-1-yl)benzonitrile (PubChem CID 167272855) has the molecular formula C26H28ClN6O2P and a molecular weight of 522.98 g/mol. Its IUPAC name is 2-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-ethyl-5-(4-oxopiperidin-1-yl)benzonitrile.
| Compound Name | 2-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-ethyl-5-(4-oxopiperidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 167272855 |
| Molecular Formula | C26H28ClN6O2P |
| Molecular Weight | 522.98 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 2-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-ethyl-5-(4-oxopiperidin-1-yl)benzonitrile |
| SMILES | CCc1cc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c(C#N)cc1N1CCC(=O)CC1 |
| InChI | InChI=1S/C26H28ClN6O2P/c1-4-17-13-22(18(15-28)14-23(17)33-11-9-19(34)10-12-33)31-26-29-16-20(27)25(32-26)30-21-7-5-6-8-24(21)36(2,3)35/h5-8,13-14,16H,4,9-12H2,1-3H3,(H2,29,30,31,32) |
| InChIKey | ZUKIDLPDYTYBSM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.98 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|