C22H25ClN5O2P — CID 174055286
7-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol (PubChem CID 174055286) has the molecular formula C22H25ClN5O2P and a molecular weight of 457.90 g/mol. Its IUPAC name is 7-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol.
| Compound Name | 7-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol |
|---|---|
| PubChem CID | 174055286 |
| Molecular Formula | C22H25ClN5O2P |
| Molecular Weight | 457.90 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 7-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol |
| SMILES | CN1CCc2cc(O)c(Nc3ncc(Cl)c(Nc4ccccc4P(C)(C)=O)n3)cc2C1 |
| InChI | InChI=1S/C22H25ClN5O2P/c1-28-9-8-14-11-19(29)18(10-15(14)13-28)26-22-24-12-16(23)21(27-22)25-17-6-4-5-7-20(17)31(2,3)30/h4-7,10-12,29H,8-9,13H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | SUXLIUVAUKXNRN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.90 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|