C19H20ClN4OP — CID 156501683
2-N-benzyl-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 156501683) has the molecular formula C19H20ClN4OP and a molecular weight of 386.82 g/mol. Its IUPAC name is 2-N-benzyl-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-benzyl-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 156501683 |
| Molecular Formula | C19H20ClN4OP |
| Molecular Weight | 386.82 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-N-benzyl-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1ccccc1Nc1nc(NCc2ccccc2)ncc1Cl |
| InChI | InChI=1S/C19H20ClN4OP/c1-26(2,25)17-11-7-6-10-16(17)23-18-15(20)13-22-19(24-18)21-12-14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | FHCMOJODKRJSEE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.82 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|