C21H22Cl2N5O2P — CID 118128995
2-chloro-N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methylphenyl]acetamide (PubChem CID 118128995) has the molecular formula C21H22Cl2N5O2P and a molecular weight of 478.32 g/mol. Its IUPAC name is 2-chloro-N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methylphenyl]acetamide.
| Compound Name | 2-chloro-N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 118128995 |
| Molecular Formula | C21H22Cl2N5O2P |
| Molecular Weight | 478.32 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 2-chloro-N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methylphenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CCl)cc1Nc1ncc(Cl)c(Nc2ccccc2P(C)(C)=O)n1 |
| InChI | InChI=1S/C21H22Cl2N5O2P/c1-13-8-9-14(25-19(29)11-22)10-17(13)27-21-24-12-15(23)20(28-21)26-16-6-4-5-7-18(16)31(2,3)30/h4-10,12H,11H2,1-3H3,(H,25,29)(H2,24,26,27,28) |
| InChIKey | BJRVCKQXPQIMSS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.32 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|