C22H29ClN7OP — CID 164820905
4-N-[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]-1-N-[2-(dimethylamino)ethyl]benzene-1,2,4-triamine (PubChem CID 164820905) has the molecular formula C22H29ClN7OP and a molecular weight of 473.95 g/mol. Its IUPAC name is 4-N-[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]-1-N-[2-(dimethylamino)ethyl]benzene-1,2,4-triamine.
| Compound Name | 4-N-[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]-1-N-[2-(dimethylamino)ethyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 164820905 |
| Molecular Formula | C22H29ClN7OP |
| Molecular Weight | 473.95 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 4-N-[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]-1-N-[2-(dimethylamino)ethyl]benzene-1,2,4-triamine |
| SMILES | CN(C)CCNc1ccc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)cc1N |
| InChI | InChI=1S/C22H29ClN7OP/c1-30(2)12-11-25-18-10-9-15(13-17(18)24)27-22-26-14-16(23)21(29-22)28-19-7-5-6-8-20(19)32(3,4)31/h5-10,13-14,25H,11-12,24H2,1-4H3,(H2,26,27,28,29) |
| InChIKey | RYEZCTSNXNWSPR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.95 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|