C25H31ClN7O3P — CID 164820911
5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-[methyl(2-pyrrolidin-1-ylethyl)amino]-3-nitrophenyl]pyrimidine-2,4-diamine (PubChem CID 164820911) has the molecular formula C25H31ClN7O3P and a molecular weight of 544.00 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-[methyl(2-pyrrolidin-1-ylethyl)amino]-3-nitrophenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-[methyl(2-pyrrolidin-1-ylethyl)amino]-3-nitrophenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164820911 |
| Molecular Formula | C25H31ClN7O3P |
| Molecular Weight | 544.00 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-[methyl(2-pyrrolidin-1-ylethyl)amino]-3-nitrophenyl]pyrimidine-2,4-diamine |
| SMILES | CN(CCN1CCCC1)c1ccc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H31ClN7O3P/c1-31(14-15-32-12-6-7-13-32)21-11-10-18(16-22(21)33(34)35)28-25-27-17-19(26)24(30-25)29-20-8-4-5-9-23(20)37(2,3)36/h4-5,8-11,16-17H,6-7,12-15H2,1-3H3,(H2,27,28,29,30) |
| InChIKey | BYVNZUJAFCOLDV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.00 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|