C18H16ClFN5O2P — CID 175186270
5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-(4-fluoro-3-nitrophenyl)pyrimidine-2,4-diamine (PubChem CID 175186270) has the molecular formula C18H16ClFN5O2P and a molecular weight of 419.78 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-(4-fluoro-3-nitrophenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-(4-fluoro-3-nitrophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 175186270 |
| Molecular Formula | C18H16ClFN5O2P |
| Molecular Weight | 419.78 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-(4-fluoro-3-nitrophenyl)pyrimidine-2,4-diamine |
| SMILES | CP(C)c1ccccc1Nc1nc(Nc2ccc(F)c([N+](=O)[O-])c2)ncc1Cl |
| InChI | InChI=1S/C18H16ClFN5O2P/c1-28(2)16-6-4-3-5-14(16)23-17-12(19)10-21-18(24-17)22-11-7-8-13(20)15(9-11)25(26)27/h3-10H,1-2H3,(H2,21,22,23,24) |
| InChIKey | IOQKJVYEOULBBF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.78 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|