C21H22ClN6P — CID 175899134
5-chloro-2-N-(2,5-dimethylindazol-6-yl)-4-N-(2-dimethylphosphanylphenyl)pyrimidine-2,4-diamine (PubChem CID 175899134) has the molecular formula C21H22ClN6P and a molecular weight of 424.88 g/mol. Its IUPAC name is 5-chloro-2-N-(2,5-dimethylindazol-6-yl)-4-N-(2-dimethylphosphanylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-(2,5-dimethylindazol-6-yl)-4-N-(2-dimethylphosphanylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 175899134 |
| Molecular Formula | C21H22ClN6P |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 5-chloro-2-N-(2,5-dimethylindazol-6-yl)-4-N-(2-dimethylphosphanylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc2cn(C)nc2cc1Nc1ncc(Cl)c(Nc2ccccc2P(C)C)n1 |
| InChI | InChI=1S/C21H22ClN6P/c1-13-9-14-12-28(2)27-18(14)10-17(13)25-21-23-11-15(22)20(26-21)24-16-7-5-6-8-19(16)29(3)4/h5-12H,1-4H3,(H2,23,24,25,26) |
| InChIKey | LWKNFCNBCRTMFJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|