C17H18ClN6O2P — CID 162715825
2-N-(6-amino-2-pyridinyl)-5-chloro-4-N-(2-dimethoxyphosphanylphenyl)pyrimidine-2,4-diamine (PubChem CID 162715825) has the molecular formula C17H18ClN6O2P and a molecular weight of 404.80 g/mol. Its IUPAC name is 2-N-(6-amino-2-pyridinyl)-5-chloro-4-N-(2-dimethoxyphosphanylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(6-amino-2-pyridinyl)-5-chloro-4-N-(2-dimethoxyphosphanylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 162715825 |
| Molecular Formula | C17H18ClN6O2P |
| Molecular Weight | 404.80 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-N-(6-amino-2-pyridinyl)-5-chloro-4-N-(2-dimethoxyphosphanylphenyl)pyrimidine-2,4-diamine |
| SMILES | COP(OC)c1ccccc1Nc1nc(Nc2cccc(N)n2)ncc1Cl |
| InChI | InChI=1S/C17H18ClN6O2P/c1-25-27(26-2)13-7-4-3-6-12(13)21-16-11(18)10-20-17(24-16)23-15-9-5-8-14(19)22-15/h3-10H,1-2H3,(H4,19,20,21,22,23,24) |
| InChIKey | OJDGEAOMTUIZMW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.80 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|