C19H17ClN5PS — CID 164853179
2-N-(1,3-benzothiazol-2-yl)-5-chloro-4-N-(2-dimethylphosphanylphenyl)pyrimidine-2,4-diamine (PubChem CID 164853179) has the molecular formula C19H17ClN5PS and a molecular weight of 413.87 g/mol. Its IUPAC name is 2-N-(1,3-benzothiazol-2-yl)-5-chloro-4-N-(2-dimethylphosphanylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(1,3-benzothiazol-2-yl)-5-chloro-4-N-(2-dimethylphosphanylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164853179 |
| Molecular Formula | C19H17ClN5PS |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 2-N-(1,3-benzothiazol-2-yl)-5-chloro-4-N-(2-dimethylphosphanylphenyl)pyrimidine-2,4-diamine |
| SMILES | CP(C)c1ccccc1Nc1nc(Nc2nc3ccccc3s2)ncc1Cl |
| InChI | InChI=1S/C19H17ClN5PS/c1-26(2)15-9-5-3-7-13(15)22-17-12(20)11-21-18(24-17)25-19-23-14-8-4-6-10-16(14)27-19/h3-11H,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | HTVXUASIIHRGGW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|