C20H19ClN5P — CID 175544803
5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-(1H-indol-6-yl)pyrimidine-2,4-diamine (PubChem CID 175544803) has the molecular formula C20H19ClN5P and a molecular weight of 395.83 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-(1H-indol-6-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-(1H-indol-6-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 175544803 |
| Molecular Formula | C20H19ClN5P |
| Molecular Weight | 395.83 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-(1H-indol-6-yl)pyrimidine-2,4-diamine |
| SMILES | CP(C)c1ccccc1Nc1nc(Nc2ccc3cc[nH]c3c2)ncc1Cl |
| InChI | InChI=1S/C20H19ClN5P/c1-27(2)18-6-4-3-5-16(18)25-19-15(21)12-23-20(26-19)24-14-8-7-13-9-10-22-17(13)11-14/h3-12,22H,1-2H3,(H2,23,24,25,26) |
| InChIKey | LICNYSSTOOEEFY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.83 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|