C21H19ClN5P — CID 164853154
5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-quinolin-8-ylpyrimidine-2,4-diamine (PubChem CID 164853154) has the molecular formula C21H19ClN5P and a molecular weight of 407.85 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-quinolin-8-ylpyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-quinolin-8-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164853154 |
| Molecular Formula | C21H19ClN5P |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-quinolin-8-ylpyrimidine-2,4-diamine |
| SMILES | CP(C)c1ccccc1Nc1nc(Nc2cccc3cccnc23)ncc1Cl |
| InChI | InChI=1S/C21H19ClN5P/c1-28(2)18-11-4-3-9-16(18)25-20-15(22)13-24-21(27-20)26-17-10-5-7-14-8-6-12-23-19(14)17/h3-13H,1-2H3,(H2,24,25,26,27) |
| InChIKey | UEUPWNVOYVUNRR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|