C29H39ClN7O5P — CID 145316969
1-[1-[4-[[5-chloro-4-(2-dimethylphosphanylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]-4-methylpiperazine-2,2,6,6-tetrol (PubChem CID 145316969) has the molecular formula C29H39ClN7O5P and a molecular weight of 632.10 g/mol. Its IUPAC name is 1-[1-[4-[[5-chloro-4-(2-dimethylphosphanylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]-4-methylpiperazine-2,2,6,6-tetrol.
| Compound Name | 1-[1-[4-[[5-chloro-4-(2-dimethylphosphanylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]-4-methylpiperazine-2,2,6,6-tetrol |
|---|---|
| PubChem CID | 145316969 |
| Molecular Formula | C29H39ClN7O5P |
| Molecular Weight | 632.10 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | 1-[1-[4-[[5-chloro-4-(2-dimethylphosphanylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]-4-methylpiperazine-2,2,6,6-tetrol |
| SMILES | COc1cc(N2CCC(N3C(O)(O)CN(C)CC3(O)O)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2P(C)C)n1 |
| InChI | InChI=1S/C29H39ClN7O5P/c1-35-17-28(38,39)37(29(40,41)18-35)19-11-13-36(14-12-19)20-9-10-22(24(15-20)42-2)33-27-31-16-21(30)26(34-27)32-23-7-5-6-8-25(23)43(3)4/h5-10,15-16,19,38-41H,11-14,17-18H2,1-4H3,(H2,31,32,33,34) |
| InChIKey | JWXPTIZNTWAHNA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 149.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.10 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|