C29H38ClN6P — CID 155005303
5-chloro-2-N-[4-[7-(dimethylamino)-2-azaspiro[3.5]nonan-2-yl]-3-methylphenyl]-4-N-(2-dimethylphosphanylphenyl)pyrimidine-2,4-diamine (PubChem CID 155005303) has the molecular formula C29H38ClN6P and a molecular weight of 537.09 g/mol. Its IUPAC name is 5-chloro-2-N-[4-[7-(dimethylamino)-2-azaspiro[3.5]nonan-2-yl]-3-methylphenyl]-4-N-(2-dimethylphosphanylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[4-[7-(dimethylamino)-2-azaspiro[3.5]nonan-2-yl]-3-methylphenyl]-4-N-(2-dimethylphosphanylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155005303 |
| Molecular Formula | C29H38ClN6P |
| Molecular Weight | 537.09 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 5-chloro-2-N-[4-[7-(dimethylamino)-2-azaspiro[3.5]nonan-2-yl]-3-methylphenyl]-4-N-(2-dimethylphosphanylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ncc(Cl)c(Nc3ccccc3P(C)C)n2)ccc1N1CC2(CCC(N(C)C)CC2)C1 |
| InChI | InChI=1S/C29H38ClN6P/c1-20-16-21(10-11-25(20)36-18-29(19-36)14-12-22(13-15-29)35(2)3)32-28-31-17-23(30)27(34-28)33-24-8-6-7-9-26(24)37(4)5/h6-11,16-17,22H,12-15,18-19H2,1-5H3,(H2,31,32,33,34) |
| InChIKey | YZTQYCQXECTPQF-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.09 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|