C35H43N6P — CID 142373173
4-N-(2-dimethylphosphanylphenyl)-2-N-[3-methyl-4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-5-phenylpyrimidine-2,4-diamine (PubChem CID 142373173) has the molecular formula C35H43N6P and a molecular weight of 578.75 g/mol. Its IUPAC name is 4-N-(2-dimethylphosphanylphenyl)-2-N-[3-methyl-4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-5-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-dimethylphosphanylphenyl)-2-N-[3-methyl-4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-5-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 142373173 |
| Molecular Formula | C35H43N6P |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | 4-N-(2-dimethylphosphanylphenyl)-2-N-[3-methyl-4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-5-phenylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ncc(-c3ccccc3)c(Nc3ccccc3P(C)C)n2)ccc1N1CCC2(CCN(C)CC2)CC1 |
| InChI | InChI=1S/C35H43N6P/c1-26-24-28(14-15-31(26)41-22-18-35(19-23-41)16-20-40(2)21-17-35)37-34-36-25-29(27-10-6-5-7-11-27)33(39-34)38-30-12-8-9-13-32(30)42(3)4/h5-15,24-25H,16-23H2,1-4H3,(H2,36,37,38,39) |
| InChIKey | RLUVDZAXGGBEGJ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|