C25H27BN7O — CID 70880907
CID 70880907 (PubChem CID 70880907) has the molecular formula C25H27BN7O and a molecular weight of 452.35 g/mol.
| Compound Name | CID 70880907 |
|---|---|
| PubChem CID | 70880907 |
| Molecular Formula | C25H27BN7O |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | — |
| SMILES | [B]=C1c2cnc(Nc3ccc(N4CCN(C)CC4)c(C)c3)nc2NC(=O)N1c1ccccc1C |
| InChI | InChI=1S/C25H27BN7O/c1-16-6-4-5-7-21(16)33-22(26)19-15-27-24(29-23(19)30-25(33)34)28-18-8-9-20(17(2)14-18)32-12-10-31(3)11-13-32/h4-9,14-15H,10-13H2,1-3H3,(H2,27,28,29,30,34) |
| InChIKey | YDUQZWMGUNLSOP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|