C28H26N10O — CID 46893374
6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-17-pyrimidin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one (PubChem CID 46893374) has the molecular formula C28H26N10O and a molecular weight of 518.59 g/mol. Its IUPAC name is 6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-17-pyrimidin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one.
| Compound Name | 6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-17-pyrimidin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
|---|---|
| PubChem CID | 46893374 |
| Molecular Formula | C28H26N10O |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-17-pyrimidin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
| SMILES | Cc1cc(Nc2ncc3c(=O)n4c(nc3n2)c2ccccc2n4-c2ncccn2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C28H26N10O/c1-18-16-19(8-9-22(18)36-14-12-35(2)13-15-36)32-27-31-17-21-24(34-27)33-25-20-6-3-4-7-23(20)37(38(25)26(21)39)28-29-10-5-11-30-28/h3-11,16-17H,12-15H2,1-2H3,(H,31,32,34) |
| InChIKey | JTQFXCLPVGVWSN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 109.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|