C30H30N10O2 — CID 67607764
6-[4-[4-(2-methoxyethyl)piperazin-1-yl]-3-methylanilino]-17-pyrimidin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one (PubChem CID 67607764) has the molecular formula C30H30N10O2 and a molecular weight of 562.64 g/mol. Its IUPAC name is 6-[4-[4-(2-methoxyethyl)piperazin-1-yl]-3-methylanilino]-17-pyrimidin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one.
| Compound Name | 6-[4-[4-(2-methoxyethyl)piperazin-1-yl]-3-methylanilino]-17-pyrimidin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
|---|---|
| PubChem CID | 67607764 |
| Molecular Formula | C30H30N10O2 |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | 6-[4-[4-(2-methoxyethyl)piperazin-1-yl]-3-methylanilino]-17-pyrimidin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
| SMILES | COCCN1CCN(c2ccc(Nc3ncc4c(=O)n5c(nc4n3)c3ccccc3n5-c3ncccn3)cc2C)CC1 |
| InChI | InChI=1S/C30H30N10O2/c1-20-18-21(8-9-24(20)38-14-12-37(13-15-38)16-17-42-2)34-29-33-19-23-26(36-29)35-27-22-6-3-4-7-25(22)39(40(27)28(23)41)30-31-10-5-11-32-30/h3-11,18-19H,12-17H2,1-2H3,(H,33,34,36) |
| InChIKey | CQZFVBJHCQPOTO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|