C31H31N9O3 — CID 66623788
14-(2-hydroxyethoxy)-6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-17-pyridin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11(16),12,14-heptaen-2-one (PubChem CID 66623788) has the molecular formula C31H31N9O3 and a molecular weight of 577.65 g/mol. Its IUPAC name is 14-(2-hydroxyethoxy)-6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-17-pyridin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11(16),12,14-heptaen-2-one.
| Compound Name | 14-(2-hydroxyethoxy)-6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-17-pyridin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11(16),12,14-heptaen-2-one |
|---|---|
| PubChem CID | 66623788 |
| Molecular Formula | C31H31N9O3 |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | 14-(2-hydroxyethoxy)-6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-17-pyridin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11(16),12,14-heptaen-2-one |
| SMILES | Cc1cc(Nc2ncc3c(=O)n4c(nc3n2)c2ccc(OCCO)cc2n4-c2ccccn2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C31H31N9O3/c1-20-17-21(6-9-25(20)38-13-11-37(2)12-14-38)34-31-33-19-24-28(36-31)35-29-23-8-7-22(43-16-15-41)18-26(23)39(40(29)30(24)42)27-5-3-4-10-32-27/h3-10,17-19,41H,11-16H2,1-2H3,(H,33,34,36) |
| InChIKey | YQCGBXFISIWKOP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|