C26H28ClN7O2 — CID 46239512
3-(2-chlorophenyl)-1-ethyl-7-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 46239512) has the molecular formula C26H28ClN7O2 and a molecular weight of 506.01 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-ethyl-7-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 3-(2-chlorophenyl)-1-ethyl-7-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 46239512 |
| Molecular Formula | C26H28ClN7O2 |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 3-(2-chlorophenyl)-1-ethyl-7-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)n(-c2ccccc2Cl)c(=O)c2cnc(Nc3ccc(N4CCN(C)CC4)c(C)c3)nc21 |
| InChI | InChI=1S/C26H28ClN7O2/c1-4-33-23-19(24(35)34(26(33)36)22-8-6-5-7-20(22)27)16-28-25(30-23)29-18-9-10-21(17(2)15-18)32-13-11-31(3)12-14-32/h5-10,15-16H,4,11-14H2,1-3H3,(H,28,29,30) |
| InChIKey | LHZHUYOBKUEKRL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|