C33H40N6O — CID 137436801
8-cyclohexyl-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-(2-methylphenyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 137436801) has the molecular formula C33H40N6O and a molecular weight of 536.72 g/mol. Its IUPAC name is 8-cyclohexyl-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-(2-methylphenyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclohexyl-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-(2-methylphenyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 137436801 |
| Molecular Formula | C33H40N6O |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | 8-cyclohexyl-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-(2-methylphenyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1ccccc1-c1c(C)c2cnc(Nc3ccc(N4CCN(C)CC4)c(C)c3)nc2n(C2CCCCC2)c1=O |
| InChI | InChI=1S/C33H40N6O/c1-22-10-8-9-13-27(22)30-24(3)28-21-34-33(36-31(28)39(32(30)40)26-11-6-5-7-12-26)35-25-14-15-29(23(2)20-25)38-18-16-37(4)17-19-38/h8-10,13-15,20-21,26H,5-7,11-12,16-19H2,1-4H3,(H,34,35,36) |
| InChIKey | MMRJNHBNBAWAKV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|