C33H39N7O2 — CID 175011900
8-(1-acetylpiperidin-3-yl)-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-phenylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 175011900) has the molecular formula C33H39N7O2 and a molecular weight of 565.72 g/mol. Its IUPAC name is 8-(1-acetylpiperidin-3-yl)-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-phenylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(1-acetylpiperidin-3-yl)-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-phenylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 175011900 |
| Molecular Formula | C33H39N7O2 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | 8-(1-acetylpiperidin-3-yl)-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-phenylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC(=O)N1CCCC(n2c(=O)c(-c3ccccc3)c(C)c3cnc(Nc4ccc(N5CCN(C)CC5)c(C)c4)nc32)C1 |
| InChI | InChI=1S/C33H39N7O2/c1-22-19-26(12-13-29(22)38-17-15-37(4)16-18-38)35-33-34-20-28-23(2)30(25-9-6-5-7-10-25)32(42)40(31(28)36-33)27-11-8-14-39(21-27)24(3)41/h5-7,9-10,12-13,19-20,27H,8,11,14-18,21H2,1-4H3,(H,34,35,36) |
| InChIKey | UNIXXCQQDPWJJP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|