C27H26N6O — CID 171547091
5-ethynyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-8-phenylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 171547091) has the molecular formula C27H26N6O and a molecular weight of 450.55 g/mol. Its IUPAC name is 5-ethynyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-8-phenylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 5-ethynyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-8-phenylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171547091 |
| Molecular Formula | C27H26N6O |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 5-ethynyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-8-phenylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | C#Cc1cc(=O)n(-c2ccccc2)c2nc(Nc3ccc(N4CCN(C)CC4)c(C)c3)ncc12 |
| InChI | InChI=1S/C27H26N6O/c1-4-20-17-25(34)33(22-8-6-5-7-9-22)26-23(20)18-28-27(30-26)29-21-10-11-24(19(2)16-21)32-14-12-31(3)13-15-32/h1,5-11,16-18H,12-15H2,2-3H3,(H,28,29,30) |
| InChIKey | XSALHSLMQMJLPJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|