C25H29N7O2 — CID 171547389
2-[5-[[5-ethynyl-8-[2-(methylamino)ethyl]-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-2-(4-methylpiperazin-1-yl)phenyl]acetaldehyde (PubChem CID 171547389) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-[5-[[5-ethynyl-8-[2-(methylamino)ethyl]-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-2-(4-methylpiperazin-1-yl)phenyl]acetaldehyde.
| Compound Name | 2-[5-[[5-ethynyl-8-[2-(methylamino)ethyl]-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-2-(4-methylpiperazin-1-yl)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 171547389 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 2-[5-[[5-ethynyl-8-[2-(methylamino)ethyl]-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-2-(4-methylpiperazin-1-yl)phenyl]acetaldehyde |
| SMILES | C#Cc1cc(=O)n(CCNC)c2nc(Nc3ccc(N4CCN(C)CC4)c(CC=O)c3)ncc12 |
| InChI | InChI=1S/C25H29N7O2/c1-4-18-16-23(34)32(9-8-26-2)24-21(18)17-27-25(29-24)28-20-5-6-22(19(15-20)7-14-33)31-12-10-30(3)11-13-31/h1,5-6,14-17,26H,7-13H2,2-3H3,(H,27,28,29) |
| InChIKey | WCQRGAMSIOTKDJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|