C26H30N8O2 — CID 67170965
6-[3-(hydroxymethyl)-4-(4-methylpiperazin-1-yl)anilino]-1-(6-methyl-2-pyridinyl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 67170965) has the molecular formula C26H30N8O2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 6-[3-(hydroxymethyl)-4-(4-methylpiperazin-1-yl)anilino]-1-(6-methyl-2-pyridinyl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-[3-(hydroxymethyl)-4-(4-methylpiperazin-1-yl)anilino]-1-(6-methyl-2-pyridinyl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 67170965 |
| Molecular Formula | C26H30N8O2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 6-[3-(hydroxymethyl)-4-(4-methylpiperazin-1-yl)anilino]-1-(6-methyl-2-pyridinyl)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(C)CC4)c(CO)c3)nc2n1-c1cccc(C)n1 |
| InChI | InChI=1S/C26H30N8O2/c1-4-10-33-25(36)21-16-27-26(30-24(21)34(33)23-7-5-6-18(2)28-23)29-20-8-9-22(19(15-20)17-35)32-13-11-31(3)12-14-32/h4-9,15-16,35H,1,10-14,17H2,2-3H3,(H,27,29,30) |
| InChIKey | SZQUGRFATRGCPA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|