C25H27N7O3 — CID 59555920
6-[3-(hydroxymethyl)-4-(4-hydroxypiperidin-1-yl)anilino]-2-prop-2-enyl-1-pyridin-2-ylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 59555920) has the molecular formula C25H27N7O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is 6-[3-(hydroxymethyl)-4-(4-hydroxypiperidin-1-yl)anilino]-2-prop-2-enyl-1-pyridin-2-ylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-[3-(hydroxymethyl)-4-(4-hydroxypiperidin-1-yl)anilino]-2-prop-2-enyl-1-pyridin-2-ylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 59555920 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 6-[3-(hydroxymethyl)-4-(4-hydroxypiperidin-1-yl)anilino]-2-prop-2-enyl-1-pyridin-2-ylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCC(O)CC4)c(CO)c3)nc2n1-c1ccccn1 |
| InChI | InChI=1S/C25H27N7O3/c1-2-11-31-24(35)20-15-27-25(29-23(20)32(31)22-5-3-4-10-26-22)28-18-6-7-21(17(14-18)16-33)30-12-8-19(34)9-13-30/h2-7,10,14-15,19,33-34H,1,8-9,11-13,16H2,(H,27,28,29) |
| InChIKey | ADNHIBZZNLXSRS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 121.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|