C27H30F3N9O2 — CID 168756006
1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-6-[4-piperazin-1-yl-3-(2,2,2-trifluoroethyl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 168756006) has the molecular formula C27H30F3N9O2 and a molecular weight of 569.59 g/mol. Its IUPAC name is 1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-6-[4-piperazin-1-yl-3-(2,2,2-trifluoroethyl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-6-[4-piperazin-1-yl-3-(2,2,2-trifluoroethyl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 168756006 |
| Molecular Formula | C27H30F3N9O2 |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 1-(6-oxo-1-propan-2-ylpyridazin-3-yl)-6-[4-piperazin-1-yl-3-(2,2,2-trifluoroethyl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCNCC4)c(CC(F)(F)F)c3)nc2n1-c1ccc(=O)n(C(C)C)n1 |
| InChI | InChI=1S/C27H30F3N9O2/c1-4-11-37-25(41)20-16-32-26(34-24(20)39(37)22-7-8-23(40)38(35-22)17(2)3)33-19-5-6-21(36-12-9-31-10-13-36)18(14-19)15-27(28,29)30/h4-8,14,16-17,31H,1,9-13,15H2,2-3H3,(H,32,33,34) |
| InChIKey | MJDQXWYISNCVOA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|